About 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate
1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate (PubChem CID 134973567) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate.
Molecular Properties
| Compound Name | 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate |
| PubChem CID | 134973567 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate |
| SMILES | CCCCOC(=O)/C=C/C(C(C)=C(C)C)C(C)C(=O)OCC |
| InChI | InChI=1S/C18H30O4/c1-7-9-12-22-17(19)11-10-16(14(5)13(3)4)15(6)18(20)21-8-2/h10-11,15-16H,7-9,12H2,1-6H3/b11-10+ |
| InChIKey | ORCBDTNOWPYTML-ZHACJKMWSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate?
The IUPAC name of 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate (CID 134973567) is 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate.
What is the SMILES notation for 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate?
The canonical SMILES for 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate is CCCCOC(=O)/C=C/C(C(C)=C(C)C)C(C)C(=O)OCC.
What is the InChIKey of 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate?
The InChIKey is ORCBDTNOWPYTML-ZHACJKMWSA-N. The full InChI is InChI=1S/C18H30O4/c1-7-9-12-22-17(19)11-10-16(14(5)13(3)4)15(6)18(20)21-8-2/h10-11,15-16H,7-9,12H2,1-6H3/b11-10+.
What are the key properties of 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate?
1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate has a molecular weight of 310.43 g/mol, XLogP of 4.06, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butyl 6-O-ethyl (E)-5-methyl-4-(3-methylbut-2-en-2-yl)hex-2-enedioate is sourced from PubChem (CID 134973567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).