C19H26O8 — CID 134973768
methoxymethyl (4E,6E)-2-[[(2S)-3-(methoxymethoxy)-2,4-dimethyl-5-oxofuran-2-yl]methyl]-3-oxoocta-4,6-dienoate (PubChem CID 134973768) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is methoxymethyl (4E,6E)-2-[[(2S)-3-(methoxymethoxy)-2,4-dimethyl-5-oxofuran-2-yl]methyl]-3-oxoocta-4,6-dienoate.
| Compound Name | methoxymethyl (4E,6E)-2-[[(2S)-3-(methoxymethoxy)-2,4-dimethyl-5-oxofuran-2-yl]methyl]-3-oxoocta-4,6-dienoate |
|---|---|
| PubChem CID | 134973768 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methoxymethyl (4E,6E)-2-[[(2S)-3-(methoxymethoxy)-2,4-dimethyl-5-oxofuran-2-yl]methyl]-3-oxoocta-4,6-dienoate |
| SMILES | C/C=C/C=C/C(=O)C(C[C@]1(C)OC(=O)C(C)=C1OCOC)C(=O)OCOC |
| InChI | InChI=1S/C19H26O8/c1-6-7-8-9-15(20)14(18(22)26-12-24-5)10-19(3)16(25-11-23-4)13(2)17(21)27-19/h6-9,14H,10-12H2,1-5H3/b7-6+,9-8+/t14?,19-/m0/s1 |
| InChIKey | WMSKJHPYFQHSGI-GNNIAWBQSA-N |
| XLogP | 2.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|