C16H22O5 — CID 15298158
(5S)-4-(methoxymethoxy)-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one (PubChem CID 15298158) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (5S)-4-(methoxymethoxy)-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one.
| Compound Name | (5S)-4-(methoxymethoxy)-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one |
|---|---|
| PubChem CID | 15298158 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (5S)-4-(methoxymethoxy)-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one |
| SMILES | C/C=C/C=C/C(=O)CC[C@]1(C)OC(=O)C(C)=C1OCOC |
| InChI | InChI=1S/C16H22O5/c1-5-6-7-8-13(17)9-10-16(3)14(20-11-19-4)12(2)15(18)21-16/h5-8H,9-11H2,1-4H3/b6-5+,8-7+/t16-/m0/s1 |
| InChIKey | NXTPKHCZBKSRAX-BITZQCGMSA-N |
| XLogP | 2.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|