C15H20O4 — CID 163076095
(5S)-4-methoxy-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one (PubChem CID 163076095) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (5S)-4-methoxy-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one.
| Compound Name | (5S)-4-methoxy-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one |
|---|---|
| PubChem CID | 163076095 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (5S)-4-methoxy-3,5-dimethyl-5-[(4E,6E)-3-oxoocta-4,6-dienyl]furan-2-one |
| SMILES | C/C=C/C=C/C(=O)CC[C@]1(C)OC(=O)C(C)=C1OC |
| InChI | InChI=1S/C15H20O4/c1-5-6-7-8-12(16)9-10-15(3)13(18-4)11(2)14(17)19-15/h5-8H,9-10H2,1-4H3/b6-5+,8-7+/t15-/m0/s1 |
| InChIKey | PXMXVRLNFPAUCF-JVGIIOCXSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|