C14H18O4 — CID 54675994
4-hydroxy-3,5-dimethyl-5-(3-oxoocta-4,6-dienyl)furan-2-one (PubChem CID 54675994) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-5-(3-oxoocta-4,6-dienyl)furan-2-one.
| Compound Name | 4-hydroxy-3,5-dimethyl-5-(3-oxoocta-4,6-dienyl)furan-2-one |
|---|---|
| PubChem CID | 54675994 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-5-(3-oxoocta-4,6-dienyl)furan-2-one |
| SMILES | CC=CC=CC(=O)CCC1(C)OC(=O)C(C)=C1O |
| InChI | InChI=1S/C14H18O4/c1-4-5-6-7-11(15)8-9-14(3)12(16)10(2)13(17)18-14/h4-7,16H,8-9H2,1-3H3 |
| InChIKey | GQFGVUPBODCMSV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|