C16H30O2Si — CID 134974069
[(3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]methanol (PubChem CID 134974069) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is [(3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]methanol.
| Compound Name | [(3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]methanol |
|---|---|
| PubChem CID | 134974069 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | [(3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]methanol |
| SMILES | CC1=C[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C1CO |
| InChI | InChI=1S/C16H30O2Si/c1-11-7-12-8-13(9-14(12)15(11)10-17)18-19(5,6)16(2,3)4/h7,12-15,17H,8-10H2,1-6H3/t12-,13+,14+,15?/m1/s1 |
| InChIKey | PQBKXNCIUCTZAM-CXJJLCSMSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|