C6H11N3O5 — CID 134974239
4-(1,2-dinitroethyl)morpholine (PubChem CID 134974239) has the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. Its IUPAC name is 4-(1,2-dinitroethyl)morpholine.
| Compound Name | 4-(1,2-dinitroethyl)morpholine |
|---|---|
| PubChem CID | 134974239 |
| Molecular Formula | C6H11N3O5 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-(1,2-dinitroethyl)morpholine |
| SMILES | O=[N+]([O-])CC(N1CCOCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N3O5/c10-8(11)5-6(9(12)13)7-1-3-14-4-2-7/h6H,1-5H2 |
| InChIKey | YXYZUMJNCJYYMD-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|