About 1-morpholin-4-ylethane-1,2-dithiol
1-morpholin-4-ylethane-1,2-dithiol (PubChem CID 123167945) has the molecular formula C6H13NOS2
and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-morpholin-4-ylethane-1,2-dithiol.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethane-1,2-dithiol |
| PubChem CID | 123167945 |
| Molecular Formula | C6H13NOS2 |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 1-morpholin-4-ylethane-1,2-dithiol |
| SMILES | SCC(S)N1CCOCC1 |
| InChI | InChI=1S/C6H13NOS2/c9-5-6(10)7-1-3-8-4-2-7/h6,9-10H,1-5H2 |
| InChIKey | VXXVXCSFKHCLSY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-morpholin-4-ylethane-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethane-1,2-dithiol?
The IUPAC name of 1-morpholin-4-ylethane-1,2-dithiol (CID 123167945) is 1-morpholin-4-ylethane-1,2-dithiol.
What is the SMILES notation for 1-morpholin-4-ylethane-1,2-dithiol?
The canonical SMILES for 1-morpholin-4-ylethane-1,2-dithiol is SCC(S)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylethane-1,2-dithiol?
The InChIKey is VXXVXCSFKHCLSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOS2/c9-5-6(10)7-1-3-8-4-2-7/h6,9-10H,1-5H2.
What are the key properties of 1-morpholin-4-ylethane-1,2-dithiol?
1-morpholin-4-ylethane-1,2-dithiol has a molecular weight of 179.31 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethane-1,2-dithiol is sourced from PubChem (CID 123167945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).