C11H22N2O5S — CID 174593846
3,3-dimorpholin-4-ylpropane-1-sulfonic acid (PubChem CID 174593846) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is 3,3-dimorpholin-4-ylpropane-1-sulfonic acid.
| Compound Name | 3,3-dimorpholin-4-ylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 174593846 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3,3-dimorpholin-4-ylpropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCC(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C11H22N2O5S/c14-19(15,16)10-1-11(12-2-6-17-7-3-12)13-4-8-18-9-5-13/h11H,1-10H2,(H,14,15,16) |
| InChIKey | OWFMIWTUKXBKOC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|