C17H24O3 — CID 134974289
(1R,2S,3R,5R,6S,7R,8R,9R,10R,14R)-6,7-dihydroxy-3,5-dimethyltetracyclo[7.5.1.02,8.010,14]pentadec-12-en-4-one (PubChem CID 134974289) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R,2S,3R,5R,6S,7R,8R,9R,10R,14R)-6,7-dihydroxy-3,5-dimethyltetracyclo[7.5.1.02,8.010,14]pentadec-12-en-4-one.
| Compound Name | (1R,2S,3R,5R,6S,7R,8R,9R,10R,14R)-6,7-dihydroxy-3,5-dimethyltetracyclo[7.5.1.02,8.010,14]pentadec-12-en-4-one |
|---|---|
| PubChem CID | 134974289 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1R,2S,3R,5R,6S,7R,8R,9R,10R,14R)-6,7-dihydroxy-3,5-dimethyltetracyclo[7.5.1.02,8.010,14]pentadec-12-en-4-one |
| SMILES | C[C@H]1C(=O)[C@H](C)[C@H]2[C@@H]3C[C@H]([C@H]4CC=C[C@@H]34)[C@H]2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O3/c1-7-13-11-6-12(10-5-3-4-9(10)11)14(13)17(20)16(19)8(2)15(7)18/h3-4,7-14,16-17,19-20H,5-6H2,1-2H3/t7-,8+,9-,10+,11-,12-,13+,14-,16+,17-/m1/s1 |
| InChIKey | FXRGDUULIUFPHB-UFOYRLJNSA-N |
| XLogP | 1.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|