C16H20O2 — CID 134974040
(1R,2S,3R,7S,8R,9R,10R,14R)-7-hydroxy-3-methyltetracyclo[7.5.1.02,8.010,14]pentadeca-5,12-dien-4-one (PubChem CID 134974040) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1R,2S,3R,7S,8R,9R,10R,14R)-7-hydroxy-3-methyltetracyclo[7.5.1.02,8.010,14]pentadeca-5,12-dien-4-one.
| Compound Name | (1R,2S,3R,7S,8R,9R,10R,14R)-7-hydroxy-3-methyltetracyclo[7.5.1.02,8.010,14]pentadeca-5,12-dien-4-one |
|---|---|
| PubChem CID | 134974040 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1R,2S,3R,7S,8R,9R,10R,14R)-7-hydroxy-3-methyltetracyclo[7.5.1.02,8.010,14]pentadeca-5,12-dien-4-one |
| SMILES | C[C@H]1C(=O)C=C[C@H](O)[C@@H]2[C@@H]3C[C@H]([C@@H]4C=CC[C@@H]43)[C@@H]21 |
| InChI | InChI=1S/C16H20O2/c1-8-13(17)5-6-14(18)16-12-7-11(15(8)16)9-3-2-4-10(9)12/h2-3,5-6,8-12,14-16,18H,4,7H2,1H3/t8-,9+,10-,11+,12+,14-,15-,16-/m0/s1 |
| InChIKey | MEUTWVZLBHGQBK-DHESPEQMSA-N |
| XLogP | 2.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|