C20H22O2 — CID 159189094
(1S,2R,3S,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol;(1S,2R,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 159189094) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1S,2R,3S,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol;(1S,2R,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2R,3S,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol;(1S,2R,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 159189094 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1S,2R,3S,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol;(1S,2R,6S,7R)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C=C[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1.O[C@H]1C=C[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H12O.C10H10O/c2*11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-4,6-11H,5H2;1-4,6-8,10H,5H2/t6-,7+,8-,9-,10+;6-,7+,8-,10+/m00/s1 |
| InChIKey | KNVYQIWTURFUBE-BQAJZMTGSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|