C14H18O2 — CID 100990300
(1S,2S,6R,7R)-5-(1-hydroxybutyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 100990300) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1S,2S,6R,7R)-5-(1-hydroxybutyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6R,7R)-5-(1-hydroxybutyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 100990300 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1S,2S,6R,7R)-5-(1-hydroxybutyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CCCC(O)C1=CC(=O)[C@@H]2[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-11(15)10-7-12(16)14-9-5-4-8(6-9)13(10)14/h4-5,7-9,11,13-15H,2-3,6H2,1H3/t8-,9+,11?,13-,14+/m0/s1 |
| InChIKey | ZDWNTLPUUFRPRO-NERBUGQESA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|