C13H14O2 — CID 10703287
(1S,2R,6S,7S,9R,10S,13R)-13-hydroxytetracyclo[7.4.0.02,7.06,10]trideca-4,11-dien-3-one (PubChem CID 10703287) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S,2R,6S,7S,9R,10S,13R)-13-hydroxytetracyclo[7.4.0.02,7.06,10]trideca-4,11-dien-3-one.
| Compound Name | (1S,2R,6S,7S,9R,10S,13R)-13-hydroxytetracyclo[7.4.0.02,7.06,10]trideca-4,11-dien-3-one |
|---|---|
| PubChem CID | 10703287 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1S,2R,6S,7S,9R,10S,13R)-13-hydroxytetracyclo[7.4.0.02,7.06,10]trideca-4,11-dien-3-one |
| SMILES | O=C1C=C[C@@H]2[C@H]3C=C[C@@H](O)[C@H]4[C@@H]3C[C@@H]2[C@@H]14 |
| InChI | InChI=1S/C13H14O2/c14-10-3-1-6-7-2-4-11(15)13-9(7)5-8(6)12(10)13/h1-4,6-10,12-14H,5H2/t6-,7-,8-,9+,10-,12-,13+/m1/s1 |
| InChIKey | XRCJYOHLUQIEPA-CYIXFBJNSA-N |
| XLogP | 1.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|