C21H32O2 — CID 155765654
(1R,2S,4S)-4-[(E,1S)-1-hydroxyoct-2-enyl]-5-prop-2-enyltricyclo[5.2.1.02,6]decan-3-one (PubChem CID 155765654) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1R,2S,4S)-4-[(E,1S)-1-hydroxyoct-2-enyl]-5-prop-2-enyltricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1R,2S,4S)-4-[(E,1S)-1-hydroxyoct-2-enyl]-5-prop-2-enyltricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 155765654 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1R,2S,4S)-4-[(E,1S)-1-hydroxyoct-2-enyl]-5-prop-2-enyltricyclo[5.2.1.02,6]decan-3-one |
| SMILES | C=CCC1C2C3CC[C@H](C3)[C@@H]2C(=O)[C@@H]1[C@@H](O)/C=C/CCCCC |
| InChI | InChI=1S/C21H32O2/c1-3-5-6-7-8-10-17(22)20-16(9-4-2)18-14-11-12-15(13-14)19(18)21(20)23/h4,8,10,14-20,22H,2-3,5-7,9,11-13H2,1H3/b10-8+/t14?,15-,16?,17+,18?,19+,20+/m1/s1 |
| InChIKey | YXYKQQZUWHYHFE-AOJNEFNBSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|