C20H30O3 — CID 163060418
(1S,3aS,5aR,10R,10aS,10bS)-10-hydroxy-8-(hydroxymethyl)-3a,5a-dimethyl-1-prop-1-en-2-yl-2,3,4,5,6,10,10a,10b-octahydro-1H-cyclohepta[e]inden-7-one (PubChem CID 163060418) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,3aS,5aR,10R,10aS,10bS)-10-hydroxy-8-(hydroxymethyl)-3a,5a-dimethyl-1-prop-1-en-2-yl-2,3,4,5,6,10,10a,10b-octahydro-1H-cyclohepta[e]inden-7-one.
| Compound Name | (1S,3aS,5aR,10R,10aS,10bS)-10-hydroxy-8-(hydroxymethyl)-3a,5a-dimethyl-1-prop-1-en-2-yl-2,3,4,5,6,10,10a,10b-octahydro-1H-cyclohepta[e]inden-7-one |
|---|---|
| PubChem CID | 163060418 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,3aS,5aR,10R,10aS,10bS)-10-hydroxy-8-(hydroxymethyl)-3a,5a-dimethyl-1-prop-1-en-2-yl-2,3,4,5,6,10,10a,10b-octahydro-1H-cyclohepta[e]inden-7-one |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)CC[C@]3(C)CC(=O)C(CO)=C[C@@H](O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H30O3/c1-12(2)14-5-6-19(3)7-8-20(4)10-16(23)13(11-21)9-15(22)18(20)17(14)19/h9,14-15,17-18,21-22H,1,5-8,10-11H2,2-4H3/t14-,15-,17+,18+,19+,20-/m1/s1 |
| InChIKey | GPBUEMVUWFHSFU-PDURBABISA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|