C21H20N2O4 — CID 134974474
(E)-5-(4-nitrophenyl)-1-phenyl-3-pyrrolidin-1-ylpent-2-ene-1,5-dione (PubChem CID 134974474) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (E)-5-(4-nitrophenyl)-1-phenyl-3-pyrrolidin-1-ylpent-2-ene-1,5-dione.
| Compound Name | (E)-5-(4-nitrophenyl)-1-phenyl-3-pyrrolidin-1-ylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 134974474 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (E)-5-(4-nitrophenyl)-1-phenyl-3-pyrrolidin-1-ylpent-2-ene-1,5-dione |
| SMILES | O=C(/C=C(\CC(=O)c1ccc([N+](=O)[O-])cc1)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4/c24-20(16-6-2-1-3-7-16)14-19(22-12-4-5-13-22)15-21(25)17-8-10-18(11-9-17)23(26)27/h1-3,6-11,14H,4-5,12-13,15H2/b19-14+ |
| InChIKey | MSFVERFZVWJSQR-XMHGGMMESA-N |
| XLogP | 4.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|