C14H24O7 — CID 134974627
methyl (5S,6R,8R)-8-hydroxy-7,7-dimethoxy-2,2-dimethyl-1,3-dioxaspiro[4.5]decane-6-carboxylate (PubChem CID 134974627) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is methyl (5S,6R,8R)-8-hydroxy-7,7-dimethoxy-2,2-dimethyl-1,3-dioxaspiro[4.5]decane-6-carboxylate.
| Compound Name | methyl (5S,6R,8R)-8-hydroxy-7,7-dimethoxy-2,2-dimethyl-1,3-dioxaspiro[4.5]decane-6-carboxylate |
|---|---|
| PubChem CID | 134974627 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl (5S,6R,8R)-8-hydroxy-7,7-dimethoxy-2,2-dimethyl-1,3-dioxaspiro[4.5]decane-6-carboxylate |
| SMILES | COC(=O)[C@H]1C(OC)(OC)[C@H](O)CC[C@@]12COC(C)(C)O2 |
| InChI | InChI=1S/C14H24O7/c1-12(2)20-8-13(21-12)7-6-9(15)14(18-4,19-5)10(13)11(16)17-3/h9-10,15H,6-8H2,1-5H3/t9-,10-,13-/m1/s1 |
| InChIKey | XEGBUASXCZLGSM-GIPNMCIBSA-N |
| XLogP | 0.44 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|