C11H17IO5 — CID 134856188
methyl (2R,4R)-1-(iodomethyl)-3,3-dimethoxy-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 134856188) has the molecular formula C11H17IO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is methyl (2R,4R)-1-(iodomethyl)-3,3-dimethoxy-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (2R,4R)-1-(iodomethyl)-3,3-dimethoxy-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 134856188 |
| Molecular Formula | C11H17IO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | methyl (2R,4R)-1-(iodomethyl)-3,3-dimethoxy-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C2(CI)CC[C@@H](O2)C1(OC)OC |
| InChI | InChI=1S/C11H17IO5/c1-14-9(13)8-10(6-12)5-4-7(17-10)11(8,15-2)16-3/h7-8H,4-6H2,1-3H3/t7-,8-,10?/m1/s1 |
| InChIKey | NZJARMDYIMSMPG-SZBHIRRCSA-N |
| XLogP | 1.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|