methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate

C13H18O6 — CID 567362

IUPACmethyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate
SMILESCOC(=O)C1CC2(CCC13CCC(=O)O3)OCCO2
InChIInChI=1S/C13H18O6/c1-16-11(15)9-8-13(17-6-7-18-13)5-4-12(9)3-2-10(14)19-12/h9H,2-8H2,1H3
InChIKeyPDZDBLFDBDOKMY-UHFFFAOYSA-N
MW270.28 g/mol
LogP0.78
Rot. Bonds1

About methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate

methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate (PubChem CID 567362) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate.

Molecular Properties

Compound Namemethyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate
PubChem CID567362
Molecular FormulaC13H18O6
Molecular Weight270.28 g/mol
Exact Mass270.11
IUPAC Namemethyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate
SMILESCOC(=O)C1CC2(CCC13CCC(=O)O3)OCCO2
InChIInChI=1S/C13H18O6/c1-16-11(15)9-8-13(17-6-7-18-13)5-4-12(9)3-2-10(14)19-12/h9H,2-8H2,1H3
InChIKeyPDZDBLFDBDOKMY-UHFFFAOYSA-N
XLogP0.78
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.28
LogP ≤ 50.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate?
The IUPAC name of methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate (CID 567362) is methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate.
What is the SMILES notation for methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate?
The canonical SMILES for methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate is COC(=O)C1CC2(CCC13CCC(=O)O3)OCCO2.
What is the InChIKey of methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate?
The InChIKey is PDZDBLFDBDOKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O6/c1-16-11(15)9-8-13(17-6-7-18-13)5-4-12(9)3-2-10(14)19-12/h9H,2-8H2,1H3.
What are the key properties of methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate?
methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate has a molecular weight of 270.28 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-4,9,12-trioxadispiro[4.2.48.25]tetradecane-14-carboxylate is sourced from PubChem (CID 567362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).