C17H26O4 — CID 134974993
methyl (E)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]hept-2-enoate (PubChem CID 134974993) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl (E)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]hept-2-enoate.
| Compound Name | methyl (E)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]hept-2-enoate |
|---|---|
| PubChem CID | 134974993 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl (E)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]hept-2-enoate |
| SMILES | CCCC/C=C(\CC1=C(O)CC(C)(C)CC1=O)C(=O)OC |
| InChI | InChI=1S/C17H26O4/c1-5-6-7-8-12(16(20)21-4)9-13-14(18)10-17(2,3)11-15(13)19/h8,18H,5-7,9-11H2,1-4H3/b12-8+ |
| InChIKey | CUZGMFXBRUNGAZ-XYOKQWHBSA-N |
| XLogP | 3.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|