C20H32O5 — CID 134975173
(1bR,3aR,4R,7aS,9S,9aS)-1b,9-dihydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,2,3,3a,5,6,7,7b,8,9-decahydrophenanthro[1,2-b]oxirene-4-carboxylic acid (PubChem CID 134975173) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1bR,3aR,4R,7aS,9S,9aS)-1b,9-dihydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,2,3,3a,5,6,7,7b,8,9-decahydrophenanthro[1,2-b]oxirene-4-carboxylic acid.
| Compound Name | (1bR,3aR,4R,7aS,9S,9aS)-1b,9-dihydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,2,3,3a,5,6,7,7b,8,9-decahydrophenanthro[1,2-b]oxirene-4-carboxylic acid |
|---|---|
| PubChem CID | 134975173 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1bR,3aR,4R,7aS,9S,9aS)-1b,9-dihydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,2,3,3a,5,6,7,7b,8,9-decahydrophenanthro[1,2-b]oxirene-4-carboxylic acid |
| SMILES | CC(C)[C@@]12OC1[C@@]1(O)CC[C@H]3[C@](C)(C(=O)O)CCC[C@]3(C)C1C[C@@H]2O |
| InChI | InChI=1S/C20H32O5/c1-11(2)20-14(21)10-13-17(3)7-5-8-18(4,16(22)23)12(17)6-9-19(13,24)15(20)25-20/h11-15,21,24H,5-10H2,1-4H3,(H,22,23)/t12-,13?,14+,15?,17+,18-,19-,20+/m1/s1 |
| InChIKey | BPKNWZRUCKICNI-LGBPGKMISA-N |
| XLogP | 2.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|