C20H30O4 — CID 78297548
6,10-dimethyl-14-propan-2-yl-2,15-dioxapentacyclo[9.5.0.01,3.05,10.014,16]hexadecane-6-carboxylic acid (PubChem CID 78297548) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 6,10-dimethyl-14-propan-2-yl-2,15-dioxapentacyclo[9.5.0.01,3.05,10.014,16]hexadecane-6-carboxylic acid.
| Compound Name | 6,10-dimethyl-14-propan-2-yl-2,15-dioxapentacyclo[9.5.0.01,3.05,10.014,16]hexadecane-6-carboxylic acid |
|---|---|
| PubChem CID | 78297548 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 6,10-dimethyl-14-propan-2-yl-2,15-dioxapentacyclo[9.5.0.01,3.05,10.014,16]hexadecane-6-carboxylic acid |
| SMILES | CC(C)C12CCC3C4(C)CCCC(C)(C(=O)O)C4CC4OC43C1O2 |
| InChI | InChI=1S/C20H30O4/c1-11(2)19-9-6-12-17(3)7-5-8-18(4,16(21)22)13(17)10-14-20(12,23-14)15(19)24-19/h11-15H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | GXWXWLWIAJYUMM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|