C8H14S — CID 134975252
2,4-dimethyl-3-methylsulfanylpenta-1,3-diene (PubChem CID 134975252) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is 2,4-dimethyl-3-methylsulfanylpenta-1,3-diene.
| Compound Name | 2,4-dimethyl-3-methylsulfanylpenta-1,3-diene |
|---|---|
| PubChem CID | 134975252 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 2,4-dimethyl-3-methylsulfanylpenta-1,3-diene |
| SMILES | C=C(C)C(SC)=C(C)C |
| InChI | InChI=1S/C8H14S/c1-6(2)8(9-5)7(3)4/h1H2,2-5H3 |
| InChIKey | IUAJBMHZDJNPHX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|