C9H13FS — CID 144789975
(3E,5E)-5-fluoro-2-methyl-4-methylsulfanylhepta-1,3,5-triene (PubChem CID 144789975) has the molecular formula C9H13FS and a molecular weight of 172.27 g/mol. Its IUPAC name is (3E,5E)-5-fluoro-2-methyl-4-methylsulfanylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-5-fluoro-2-methyl-4-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144789975 |
| Molecular Formula | C9H13FS |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3E,5E)-5-fluoro-2-methyl-4-methylsulfanylhepta-1,3,5-triene |
| SMILES | C=C(C)/C=C(SC)\C(F)=C/C |
| InChI | InChI=1S/C9H13FS/c1-5-8(10)9(11-4)6-7(2)3/h5-6H,2H2,1,3-4H3/b8-5+,9-6+ |
| InChIKey | SUIQKCJEUGIKND-XVYDYJIPSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|