C9H10F2S — CID 123538472
2-ethenylidene-4,6-difluorohepta-3,5-diene-1-thiol (PubChem CID 123538472) has the molecular formula C9H10F2S and a molecular weight of 188.24 g/mol. Its IUPAC name is 2-ethenylidene-4,6-difluorohepta-3,5-diene-1-thiol.
| Compound Name | 2-ethenylidene-4,6-difluorohepta-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 123538472 |
| Molecular Formula | C9H10F2S |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-ethenylidene-4,6-difluorohepta-3,5-diene-1-thiol |
| SMILES | C=C=C(C=C(F)C=C(C)F)CS |
| InChI | InChI=1S/C9H10F2S/c1-3-8(6-12)5-9(11)4-7(2)10/h4-5,12H,1,6H2,2H3 |
| InChIKey | UVKDIKSKCKTLBH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|