C10H15FS — CID 143597734
[(1E,3Z,5Z)-3,5-dimethylocta-1,3,5-trienyl] thiohypofluorite (PubChem CID 143597734) has the molecular formula C10H15FS and a molecular weight of 186.29 g/mol. Its IUPAC name is [(1E,3Z,5Z)-3,5-dimethylocta-1,3,5-trienyl] thiohypofluorite.
| Compound Name | [(1E,3Z,5Z)-3,5-dimethylocta-1,3,5-trienyl] thiohypofluorite |
|---|---|
| PubChem CID | 143597734 |
| Molecular Formula | C10H15FS |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | [(1E,3Z,5Z)-3,5-dimethylocta-1,3,5-trienyl] thiohypofluorite |
| SMILES | CC/C=C(C)\C=C(C)/C=C/SF |
| InChI | InChI=1S/C10H15FS/c1-4-5-9(2)8-10(3)6-7-12-11/h5-8H,4H2,1-3H3/b7-6+,9-5-,10-8- |
| InChIKey | PXQJPBHXTCOCNX-YNEORXBLSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|