C8H11F3S — CID 143617726
[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-trifluoro-λ4-sulfane (PubChem CID 143617726) has the molecular formula C8H11F3S and a molecular weight of 196.24 g/mol. Its IUPAC name is [(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-trifluoro-λ4-sulfane.
| Compound Name | [(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-trifluoro-λ4-sulfane |
|---|---|
| PubChem CID | 143617726 |
| Molecular Formula | C8H11F3S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | [(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]-trifluoro-λ4-sulfane |
| SMILES | C=C(C)/C=C(/C)C(=C)S(F)(F)F |
| InChI | InChI=1S/C8H11F3S/c1-6(2)5-7(3)8(4)12(9,10)11/h5H,1,4H2,2-3H3/b7-5- |
| InChIKey | RHGNRQRTDBHFDR-ALCCZGGFSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|