C8H13F5S — CID 143815686
pentafluoro-[(3E,5Z)-octa-3,5-dien-4-yl]-λ6-sulfane (PubChem CID 143815686) has the molecular formula C8H13F5S and a molecular weight of 236.25 g/mol. Its IUPAC name is pentafluoro-[(3E,5Z)-octa-3,5-dien-4-yl]-λ6-sulfane.
| Compound Name | pentafluoro-[(3E,5Z)-octa-3,5-dien-4-yl]-λ6-sulfane |
|---|---|
| PubChem CID | 143815686 |
| Molecular Formula | C8H13F5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | pentafluoro-[(3E,5Z)-octa-3,5-dien-4-yl]-λ6-sulfane |
| SMILES | CC/C=C\C(=C/CC)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C8H13F5S/c1-3-5-7-8(6-4-2)14(9,10,11,12)13/h5-7H,3-4H2,1-2H3/b7-5-,8-6+ |
| InChIKey | HEZCWEGLSFPEER-CGXWXWIYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|