C8H13F5S — CID 143330422
pentafluoro-[(2E,6Z)-octa-2,6-dien-3-yl]-λ6-sulfane (PubChem CID 143330422) has the molecular formula C8H13F5S and a molecular weight of 236.25 g/mol. Its IUPAC name is pentafluoro-[(2E,6Z)-octa-2,6-dien-3-yl]-λ6-sulfane.
| Compound Name | pentafluoro-[(2E,6Z)-octa-2,6-dien-3-yl]-λ6-sulfane |
|---|---|
| PubChem CID | 143330422 |
| Molecular Formula | C8H13F5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | pentafluoro-[(2E,6Z)-octa-2,6-dien-3-yl]-λ6-sulfane |
| SMILES | C/C=C\CC/C(=C\C)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C8H13F5S/c1-3-5-6-7-8(4-2)14(9,10,11,12)13/h3-5H,6-7H2,1-2H3/b5-3-,8-4+ |
| InChIKey | NPELHBNPIDACLA-VOGDQUTBSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|