C9H16O2S — CID 89322028
(2E,6Z)-3-methylsulfonylocta-2,6-diene (PubChem CID 89322028) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is (2E,6Z)-3-methylsulfonylocta-2,6-diene.
| Compound Name | (2E,6Z)-3-methylsulfonylocta-2,6-diene |
|---|---|
| PubChem CID | 89322028 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (2E,6Z)-3-methylsulfonylocta-2,6-diene |
| SMILES | C/C=C\CC/C(=C\C)S(C)(=O)=O |
| InChI | InChI=1S/C9H16O2S/c1-4-6-7-8-9(5-2)12(3,10)11/h4-6H,7-8H2,1-3H3/b6-4-,9-5+ |
| InChIKey | HGYDAJFHKGGJIT-QUNSIMLLSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|