C8H11F5S — CID 143857757
[(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]-pentafluoro-λ6-sulfane (PubChem CID 143857757) has the molecular formula C8H11F5S and a molecular weight of 234.23 g/mol. Its IUPAC name is [(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]-pentafluoro-λ6-sulfane.
| Compound Name | [(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 143857757 |
| Molecular Formula | C8H11F5S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | [(3E)-2,5-dimethylhexa-1,3,5-trien-3-yl]-pentafluoro-λ6-sulfane |
| SMILES | C=C(C)/C=C(\C(=C)C)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C8H11F5S/c1-6(2)5-8(7(3)4)14(9,10,11,12)13/h5H,1,3H2,2,4H3/b8-5+ |
| InChIKey | PIPQZIZBOMDLAI-VMPITWQZSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|