C7H9F5S — CID 143935419
pentafluoro-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-λ6-sulfane (PubChem CID 143935419) has the molecular formula C7H9F5S and a molecular weight of 220.21 g/mol. Its IUPAC name is pentafluoro-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-λ6-sulfane.
| Compound Name | pentafluoro-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-λ6-sulfane |
|---|---|
| PubChem CID | 143935419 |
| Molecular Formula | C7H9F5S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | pentafluoro-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-λ6-sulfane |
| SMILES | C=C(C)/C=C\C(=C)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C7H9F5S/c1-6(2)4-5-7(3)13(8,9,10,11)12/h4-5H,1,3H2,2H3/b5-4- |
| InChIKey | RIEBRWOUVFEDET-PLNGDYQASA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|