C13H21F3S — CID 143345614
ethane;(2E,3Z,5Z)-2-ethylidene-5-(2,2,2-trifluoroethyl)hepta-3,5-diene-1-thiol (PubChem CID 143345614) has the molecular formula C13H21F3S and a molecular weight of 266.37 g/mol. Its IUPAC name is ethane;(2E,3Z,5Z)-2-ethylidene-5-(2,2,2-trifluoroethyl)hepta-3,5-diene-1-thiol.
| Compound Name | ethane;(2E,3Z,5Z)-2-ethylidene-5-(2,2,2-trifluoroethyl)hepta-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 143345614 |
| Molecular Formula | C13H21F3S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethane;(2E,3Z,5Z)-2-ethylidene-5-(2,2,2-trifluoroethyl)hepta-3,5-diene-1-thiol |
| SMILES | C/C=C(\C=C/C(=C\C)CS)CC(F)(F)F.CC |
| InChI | InChI=1S/C11H15F3S.C2H6/c1-3-9(7-11(12,13)14)5-6-10(4-2)8-15;1-2/h3-6,15H,7-8H2,1-2H3;1-2H3/b6-5-,9-3+,10-4+; |
| InChIKey | SCXPQCBBRCYECT-ORXQRZQCSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|