C11H13FS — CID 90896513
10-fluoro-4,7-dimethyl-5λ6-thiaspiro[4.5]deca-1(5),3,5(10),6,8-pentaene (PubChem CID 90896513) has the molecular formula C11H13FS and a molecular weight of 196.29 g/mol. Its IUPAC name is 10-fluoro-4,7-dimethyl-5λ6-thiaspiro[4.5]deca-1(5),3,5(10),6,8-pentaene.
| Compound Name | 10-fluoro-4,7-dimethyl-5λ6-thiaspiro[4.5]deca-1(5),3,5(10),6,8-pentaene |
|---|---|
| PubChem CID | 90896513 |
| Molecular Formula | C11H13FS |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 10-fluoro-4,7-dimethyl-5λ6-thiaspiro[4.5]deca-1(5),3,5(10),6,8-pentaene |
| SMILES | CC1=CS2(=CCC=C2C)=C(F)C=C1 |
| InChI | InChI=1S/C11H13FS/c1-9-5-6-11(12)13(8-9)7-3-4-10(13)2/h4-8H,3H2,1-2H3 |
| InChIKey | MHECFAIFKSNVLR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|