About 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene
5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene (PubChem CID 123954887) has the molecular formula C9H9FS
and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene.
Analyze 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene?
The IUPAC name of 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene (CID 123954887) is 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene.
What is the SMILES notation for 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene?
The canonical SMILES for 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene is CC1=C(F)CC2C=CSC2=C1.
What is the InChIKey of 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene?
The InChIKey is RFCQAJLMXOMCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FS/c1-6-4-9-7(2-3-11-9)5-8(6)10/h2-4,7H,5H2,1H3.
What are the key properties of 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene?
5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene has a molecular weight of 168.24 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyl-3a,4-dihydro-1-benzothiophene is sourced from PubChem (CID 123954887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).