C11H11F3S — CID 142164344
(3Z)-4-methyl-3-[(2E)-3-(trifluoromethyl)penta-2,4-dienylidene]thiophene (PubChem CID 142164344) has the molecular formula C11H11F3S and a molecular weight of 232.27 g/mol. Its IUPAC name is (3Z)-4-methyl-3-[(2E)-3-(trifluoromethyl)penta-2,4-dienylidene]thiophene.
| Compound Name | (3Z)-4-methyl-3-[(2E)-3-(trifluoromethyl)penta-2,4-dienylidene]thiophene |
|---|---|
| PubChem CID | 142164344 |
| Molecular Formula | C11H11F3S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (3Z)-4-methyl-3-[(2E)-3-(trifluoromethyl)penta-2,4-dienylidene]thiophene |
| SMILES | C=C/C(=C\C=C1/CSC=C1C)C(F)(F)F |
| InChI | InChI=1S/C11H11F3S/c1-3-10(11(12,13)14)5-4-9-7-15-6-8(9)2/h3-6H,1,7H2,2H3/b9-4+,10-5+ |
| InChIKey | OJALYZLXNFMHCU-LUZURFALSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|