C8H6F3S- — CID 166441103
5-[2-(trifluoromethylsulfanyl)ethylidene]cyclopenta-1,3-diene (PubChem CID 166441103) has the molecular formula C8H6F3S- and a molecular weight of 191.20 g/mol. Its IUPAC name is 5-[2-(trifluoromethylsulfanyl)ethylidene]cyclopenta-1,3-diene.
| Compound Name | 5-[2-(trifluoromethylsulfanyl)ethylidene]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 166441103 |
| Molecular Formula | C8H6F3S- |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | 5-[2-(trifluoromethylsulfanyl)ethylidene]cyclopenta-1,3-diene |
| SMILES | FC(F)(F)S[CH-]C=C1C=CC=C1 |
| InChI | InChI=1S/C8H6F3S/c9-8(10,11)12-6-5-7-3-1-2-4-7/h1-6H/q-1 |
| InChIKey | FQPZZEIQFASTIW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|