C8H9F3S — CID 144530549
(3Z)-2-methylsulfanyl-5-(trifluoromethyl)hexa-1,3,5-triene (PubChem CID 144530549) has the molecular formula C8H9F3S and a molecular weight of 194.22 g/mol. Its IUPAC name is (3Z)-2-methylsulfanyl-5-(trifluoromethyl)hexa-1,3,5-triene.
| Compound Name | (3Z)-2-methylsulfanyl-5-(trifluoromethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 144530549 |
| Molecular Formula | C8H9F3S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (3Z)-2-methylsulfanyl-5-(trifluoromethyl)hexa-1,3,5-triene |
| SMILES | C=C(/C=C\C(=C)C(F)(F)F)SC |
| InChI | InChI=1S/C8H9F3S/c1-6(8(9,10)11)4-5-7(2)12-3/h4-5H,1-2H2,3H3/b5-4- |
| InChIKey | ITPBAVXLGDJKBK-PLNGDYQASA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|