C14H17F7S — CID 123610113
4-ethylsulfanyl-7,8,8,8-tetrafluoro-2,3,6-trimethyl-7-(trifluoromethyl)octa-1,3,5-triene (PubChem CID 123610113) has the molecular formula C14H17F7S and a molecular weight of 350.34 g/mol. Its IUPAC name is 4-ethylsulfanyl-7,8,8,8-tetrafluoro-2,3,6-trimethyl-7-(trifluoromethyl)octa-1,3,5-triene.
| Compound Name | 4-ethylsulfanyl-7,8,8,8-tetrafluoro-2,3,6-trimethyl-7-(trifluoromethyl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 123610113 |
| Molecular Formula | C14H17F7S |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-ethylsulfanyl-7,8,8,8-tetrafluoro-2,3,6-trimethyl-7-(trifluoromethyl)octa-1,3,5-triene |
| SMILES | C=C(C)C(C)=C(C=C(C)C(F)(C(F)(F)F)C(F)(F)F)SCC |
| InChI | InChI=1S/C14H17F7S/c1-6-22-11(10(5)8(2)3)7-9(4)12(15,13(16,17)18)14(19,20)21/h7H,2,6H2,1,3-5H3 |
| InChIKey | PINZIHPNRLLURW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|