C13H19F3S — CID 91076316
1,1,1-trifluoro-4-(2-methylbut-3-en-2-ylsulfanyl)octa-3,5-diene (PubChem CID 91076316) has the molecular formula C13H19F3S and a molecular weight of 264.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(2-methylbut-3-en-2-ylsulfanyl)octa-3,5-diene.
| Compound Name | 1,1,1-trifluoro-4-(2-methylbut-3-en-2-ylsulfanyl)octa-3,5-diene |
|---|---|
| PubChem CID | 91076316 |
| Molecular Formula | C13H19F3S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1,1,1-trifluoro-4-(2-methylbut-3-en-2-ylsulfanyl)octa-3,5-diene |
| SMILES | C=CC(C)(C)SC(C=CCC)=CCC(F)(F)F |
| InChI | InChI=1S/C13H19F3S/c1-5-7-8-11(9-10-13(14,15)16)17-12(3,4)6-2/h6-9H,2,5,10H2,1,3-4H3 |
| InChIKey | DECQIXPGQYXCEK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|