C13H23F3S — CID 145395031
ethane;(3E)-5-methylidene-3-(trifluoromethylsulfanyl)hepta-1,3-diene (PubChem CID 145395031) has the molecular formula C13H23F3S and a molecular weight of 268.39 g/mol. Its IUPAC name is ethane;(3E)-5-methylidene-3-(trifluoromethylsulfanyl)hepta-1,3-diene.
| Compound Name | ethane;(3E)-5-methylidene-3-(trifluoromethylsulfanyl)hepta-1,3-diene |
|---|---|
| PubChem CID | 145395031 |
| Molecular Formula | C13H23F3S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | ethane;(3E)-5-methylidene-3-(trifluoromethylsulfanyl)hepta-1,3-diene |
| SMILES | C=C/C(=C\C(=C)CC)SC(F)(F)F.CC.CC |
| InChI | InChI=1S/C9H11F3S.2C2H6/c1-4-7(3)6-8(5-2)13-9(10,11)12;2*1-2/h5-6H,2-4H2,1H3;2*1-2H3/b8-6+;; |
| InChIKey | JSEKBCRZYMUFHB-OVGXCEQFSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|