C12H15F3S — CID 143964347
1-(2-methylbut-3-en-2-ylsulfanyl)-3-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 143964347) has the molecular formula C12H15F3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-(2-methylbut-3-en-2-ylsulfanyl)-3-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 1-(2-methylbut-3-en-2-ylsulfanyl)-3-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143964347 |
| Molecular Formula | C12H15F3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(2-methylbut-3-en-2-ylsulfanyl)-3-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | C=CC(C)(C)SC1=CC(C(F)(F)F)=CCC1 |
| InChI | InChI=1S/C12H15F3S/c1-4-11(2,3)16-10-7-5-6-9(8-10)12(13,14)15/h4,6,8H,1,5,7H2,2-3H3 |
| InChIKey | RGTLXJMCBDYAGR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|