C9H13FS — CID 123406958
4-fluoro-3-(methylsulfanylmethyl)hepta-1,3,5-triene (PubChem CID 123406958) has the molecular formula C9H13FS and a molecular weight of 172.27 g/mol. Its IUPAC name is 4-fluoro-3-(methylsulfanylmethyl)hepta-1,3,5-triene.
| Compound Name | 4-fluoro-3-(methylsulfanylmethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 123406958 |
| Molecular Formula | C9H13FS |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-fluoro-3-(methylsulfanylmethyl)hepta-1,3,5-triene |
| SMILES | C=CC(CSC)=C(F)C=CC |
| InChI | InChI=1S/C9H13FS/c1-4-6-9(10)8(5-2)7-11-3/h4-6H,2,7H2,1,3H3 |
| InChIKey | PEFRINIGFFSSPQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|