C10H14ClFS — CID 142939621
(3Z)-4-chloro-2-fluoro-3-(propylsulfanylmethyl)hexa-1,3,5-triene (PubChem CID 142939621) has the molecular formula C10H14ClFS and a molecular weight of 220.74 g/mol. Its IUPAC name is (3Z)-4-chloro-2-fluoro-3-(propylsulfanylmethyl)hexa-1,3,5-triene.
| Compound Name | (3Z)-4-chloro-2-fluoro-3-(propylsulfanylmethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 142939621 |
| Molecular Formula | C10H14ClFS |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (3Z)-4-chloro-2-fluoro-3-(propylsulfanylmethyl)hexa-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(/CSCCC)C(=C)F |
| InChI | InChI=1S/C10H14ClFS/c1-4-6-13-7-9(8(3)12)10(11)5-2/h5H,2-4,6-7H2,1H3/b10-9+ |
| InChIKey | AGMUCXVCDJNJDE-MDZDMXLPSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|