C9H13ClS — CID 143959185
(1E,3E)-1-chloro-4-(ethylsulfanylmethyl)hexa-1,3,5-triene (PubChem CID 143959185) has the molecular formula C9H13ClS and a molecular weight of 188.72 g/mol. Its IUPAC name is (1E,3E)-1-chloro-4-(ethylsulfanylmethyl)hexa-1,3,5-triene.
| Compound Name | (1E,3E)-1-chloro-4-(ethylsulfanylmethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143959185 |
| Molecular Formula | C9H13ClS |
| Molecular Weight | 188.72 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (1E,3E)-1-chloro-4-(ethylsulfanylmethyl)hexa-1,3,5-triene |
| SMILES | C=C/C(=C\C=C\Cl)CSCC |
| InChI | InChI=1S/C9H13ClS/c1-3-9(6-5-7-10)8-11-4-2/h3,5-7H,1,4,8H2,2H3/b7-5+,9-6+ |
| InChIKey | KOTAMTRAWXJOPH-PDTNFJSOSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.72 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|