C15H23ClS — CID 143260700
(3Z,5E)-6-[(3Z)-5-chloropenta-1,3-dien-2-yl]sulfanyl-3-methylhepta-1,3,5-triene;ethane (PubChem CID 143260700) has the molecular formula C15H23ClS and a molecular weight of 270.87 g/mol. Its IUPAC name is (3Z,5E)-6-[(3Z)-5-chloropenta-1,3-dien-2-yl]sulfanyl-3-methylhepta-1,3,5-triene;ethane.
| Compound Name | (3Z,5E)-6-[(3Z)-5-chloropenta-1,3-dien-2-yl]sulfanyl-3-methylhepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 143260700 |
| Molecular Formula | C15H23ClS |
| Molecular Weight | 270.87 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (3Z,5E)-6-[(3Z)-5-chloropenta-1,3-dien-2-yl]sulfanyl-3-methylhepta-1,3,5-triene;ethane |
| SMILES | C=C/C(C)=C\C=C(/C)SC(=C)/C=C\CCl.CC |
| InChI | InChI=1S/C13H17ClS.C2H6/c1-5-11(2)8-9-13(4)15-12(3)7-6-10-14;1-2/h5-9H,1,3,10H2,2,4H3;1-2H3/b7-6-,11-8-,13-9+; |
| InChIKey | RUJYWXPLEVGJIX-WJEFRGHYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.87 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|