C10H17ClS — CID 144523026
1-chloro-2-methylsulfanylethane;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 144523026) has the molecular formula C10H17ClS and a molecular weight of 204.77 g/mol. Its IUPAC name is 1-chloro-2-methylsulfanylethane;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | 1-chloro-2-methylsulfanylethane;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 144523026 |
| Molecular Formula | C10H17ClS |
| Molecular Weight | 204.77 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-chloro-2-methylsulfanylethane;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.CSCCCl |
| InChI | InChI=1S/C7H10.C3H7ClS/c1-4-6-7(3)5-2;1-5-3-2-4/h4-6H,1-2H2,3H3;2-3H2,1H3/b7-6-; |
| InChIKey | ZGDVHKKDPFZJPH-NAFXZHHSSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|