C9H18S — CID 143043745
ethane;(3Z)-3-methyl-5-methylsulfanylpenta-1,3-diene (PubChem CID 143043745) has the molecular formula C9H18S and a molecular weight of 158.31 g/mol. Its IUPAC name is ethane;(3Z)-3-methyl-5-methylsulfanylpenta-1,3-diene.
| Compound Name | ethane;(3Z)-3-methyl-5-methylsulfanylpenta-1,3-diene |
|---|---|
| PubChem CID | 143043745 |
| Molecular Formula | C9H18S |
| Molecular Weight | 158.31 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | ethane;(3Z)-3-methyl-5-methylsulfanylpenta-1,3-diene |
| SMILES | C=C/C(C)=C\CSC.CC |
| InChI | InChI=1S/C7H12S.C2H6/c1-4-7(2)5-6-8-3;1-2/h4-5H,1,6H2,2-3H3;1-2H3/b7-5-; |
| InChIKey | RCOWEXCJWFCDDB-YJOCEBFMSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|