C10H15FS — CID 162749753
(E)-1-fluoro-2-methyl-1-[(2E)-penta-2,4-dienyl]sulfanylbut-1-ene (PubChem CID 162749753) has the molecular formula C10H15FS and a molecular weight of 186.29 g/mol. Its IUPAC name is (E)-1-fluoro-2-methyl-1-[(2E)-penta-2,4-dienyl]sulfanylbut-1-ene.
| Compound Name | (E)-1-fluoro-2-methyl-1-[(2E)-penta-2,4-dienyl]sulfanylbut-1-ene |
|---|---|
| PubChem CID | 162749753 |
| Molecular Formula | C10H15FS |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (E)-1-fluoro-2-methyl-1-[(2E)-penta-2,4-dienyl]sulfanylbut-1-ene |
| SMILES | C=C/C=C/CS/C(F)=C(\C)CC |
| InChI | InChI=1S/C10H15FS/c1-4-6-7-8-12-10(11)9(3)5-2/h4,6-7H,1,5,8H2,2-3H3/b7-6+,10-9+ |
| InChIKey | QEEQBGKYOFITSL-AVQMFFATSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|